C14H26O — CID 142150045
3,4-ditert-butylfuran;ethane (PubChem CID 142150045) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is 3,4-ditert-butylfuran;ethane.
| Compound Name | 3,4-ditert-butylfuran;ethane |
|---|---|
| PubChem CID | 142150045 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 3,4-ditert-butylfuran;ethane |
| SMILES | CC.CC(C)(C)c1cocc1C(C)(C)C |
| InChI | InChI=1S/C12H20O.C2H6/c1-11(2,3)9-7-13-8-10(9)12(4,5)6;1-2/h7-8H,1-6H3;1-2H3 |
| InChIKey | IARRXKNBEAKKNY-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |