C18H14ClFN2O3 — CID 142151657
2-[5-chloro-2-fluoro-4-[(2-methyl-1H-indole-3-carbonyl)amino]phenyl]acetic acid (PubChem CID 142151657) has the molecular formula C18H14ClFN2O3 and a molecular weight of 360.77 g/mol. Its IUPAC name is 2-[5-chloro-2-fluoro-4-[(2-methyl-1H-indole-3-carbonyl)amino]phenyl]acetic acid.
| Compound Name | 2-[5-chloro-2-fluoro-4-[(2-methyl-1H-indole-3-carbonyl)amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 142151657 |
| Molecular Formula | C18H14ClFN2O3 |
| Molecular Weight | 360.77 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 2-[5-chloro-2-fluoro-4-[(2-methyl-1H-indole-3-carbonyl)amino]phenyl]acetic acid |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)Nc1cc(F)c(CC(=O)O)cc1Cl |
| InChI | InChI=1S/C18H14ClFN2O3/c1-9-17(11-4-2-3-5-14(11)21-9)18(25)22-15-8-13(20)10(6-12(15)19)7-16(23)24/h2-6,8,21H,7H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | GNUAMYZANXBVDZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.77 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |