C18H12ClF3N2O2 — CID 4916612
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide (PubChem CID 4916612) has the molecular formula C18H12ClF3N2O2 and a molecular weight of 380.75 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 4916612 |
| Molecular Formula | C18H12ClF3N2O2 |
| Molecular Weight | 380.75 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)C(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C18H12ClF3N2O2/c1-9-15(11-4-2-3-5-13(11)23-9)16(25)17(26)24-14-8-10(18(20,21)22)6-7-12(14)19/h2-8,23H,1H3,(H,24,26) |
| InChIKey | YQEZMPKEFBETTR-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.75 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|