C37H46N6O2 — CID 142152527
2-[[3-[amino-[(E)-cyclohexa-2,4-dien-1-ylideneamino]amino]-2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]methyl]-6-(benzotriazol-2-yl)-4-tert-butylphenol (PubChem CID 142152527) has the molecular formula C37H46N6O2 and a molecular weight of 606.82 g/mol. Its IUPAC name is 2-[[3-[amino-[(E)-cyclohexa-2,4-dien-1-ylideneamino]amino]-2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]methyl]-6-(benzotriazol-2-yl)-4-tert-butylphenol.
| Compound Name | 2-[[3-[amino-[(E)-cyclohexa-2,4-dien-1-ylideneamino]amino]-2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]methyl]-6-(benzotriazol-2-yl)-4-tert-butylphenol |
|---|---|
| PubChem CID | 142152527 |
| Molecular Formula | C37H46N6O2 |
| Molecular Weight | 606.82 g/mol |
| Exact Mass | 606.37 |
| IUPAC Name | 2-[[3-[amino-[(E)-cyclohexa-2,4-dien-1-ylideneamino]amino]-2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]methyl]-6-(benzotriazol-2-yl)-4-tert-butylphenol |
| SMILES | CC(C)(C)CC(C)(C)c1cc(Cc2cc(C(C)(C)C)cc(-n3nc4ccccc4n3)c2O)c(O)c(N(N)/N=C2/C=CC=CC2)c1 |
| InChI | InChI=1S/C37H46N6O2/c1-35(2,3)23-37(7,8)27-20-25(33(44)31(22-27)42(38)39-28-14-10-9-11-15-28)18-24-19-26(36(4,5)6)21-32(34(24)45)43-40-29-16-12-13-17-30(29)41-43/h9-14,16-17,19-22,44-45H,15,18,23,38H2,1-8H3/b39-28- |
| InChIKey | OCYFHBGEGPYUKW-WGSLGHPRSA-N |
| XLogP | 7.99 |
| TPSA | 112.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.82 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|