C41H52N6O2 — CID 153323444
2-(benzotriazol-2-yl)-6-[[3-(benzotriazol-2-yl)-4-hydroxy-1-(2,4,4-trimethylpentan-2-yl)cyclohexa-2,4-dien-1-yl]methyl]-4-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 153323444) has the molecular formula C41H52N6O2 and a molecular weight of 660.91 g/mol. Its IUPAC name is 2-(benzotriazol-2-yl)-6-[[3-(benzotriazol-2-yl)-4-hydroxy-1-(2,4,4-trimethylpentan-2-yl)cyclohexa-2,4-dien-1-yl]methyl]-4-(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 2-(benzotriazol-2-yl)-6-[[3-(benzotriazol-2-yl)-4-hydroxy-1-(2,4,4-trimethylpentan-2-yl)cyclohexa-2,4-dien-1-yl]methyl]-4-(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 153323444 |
| Molecular Formula | C41H52N6O2 |
| Molecular Weight | 660.91 g/mol |
| Exact Mass | 660.42 |
| IUPAC Name | 2-(benzotriazol-2-yl)-6-[[3-(benzotriazol-2-yl)-4-hydroxy-1-(2,4,4-trimethylpentan-2-yl)cyclohexa-2,4-dien-1-yl]methyl]-4-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | CC(C)(C)CC(C)(C)c1cc(CC2(C(C)(C)CC(C)(C)C)C=C(n3nc4ccccc4n3)C(O)=CC2)c(O)c(-n2nc3ccccc3n2)c1 |
| InChI | InChI=1S/C41H52N6O2/c1-37(2,3)25-39(7,8)28-21-27(36(49)33(22-28)46-42-29-15-11-12-16-30(29)43-46)23-41(40(9,10)26-38(4,5)6)20-19-35(48)34(24-41)47-44-31-17-13-14-18-32(31)45-47/h11-19,21-22,24,48-49H,20,23,25-26H2,1-10H3 |
| InChIKey | FYFDJZAGWMWDOK-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.91 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |