C42H54N6O2 — CID 145203335
2-(benzotriazol-2-yl)-6-[(3Z,5E)-4-(benzotriazol-2-yl)-3-hydroxy-6,7,7,9,9-pentamethyl-2-methylidenedeca-3,5-dienyl]-4-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 145203335) has the molecular formula C42H54N6O2 and a molecular weight of 674.93 g/mol. Its IUPAC name is 2-(benzotriazol-2-yl)-6-[(3Z,5E)-4-(benzotriazol-2-yl)-3-hydroxy-6,7,7,9,9-pentamethyl-2-methylidenedeca-3,5-dienyl]-4-(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 2-(benzotriazol-2-yl)-6-[(3Z,5E)-4-(benzotriazol-2-yl)-3-hydroxy-6,7,7,9,9-pentamethyl-2-methylidenedeca-3,5-dienyl]-4-(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 145203335 |
| Molecular Formula | C42H54N6O2 |
| Molecular Weight | 674.93 g/mol |
| Exact Mass | 674.43 |
| IUPAC Name | 2-(benzotriazol-2-yl)-6-[(3Z,5E)-4-(benzotriazol-2-yl)-3-hydroxy-6,7,7,9,9-pentamethyl-2-methylidenedeca-3,5-dienyl]-4-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | C=C(Cc1cc(C(C)(C)CC(C)(C)C)cc(-n2nc3ccccc3n2)c1O)/C(O)=C(\C=C(/C)C(C)(C)CC(C)(C)C)n1nc2ccccc2n1 |
| InChI | InChI=1S/C42H54N6O2/c1-27(37(49)35(22-28(2)41(9,10)25-39(3,4)5)47-43-31-17-13-14-18-32(31)44-47)21-29-23-30(42(11,12)26-40(6,7)8)24-36(38(29)50)48-45-33-19-15-16-20-34(33)46-48/h13-20,22-24,49-50H,1,21,25-26H2,2-12H3/b28-22+,37-35- |
| InChIKey | HAQNYFORJFWAPE-JGOIJAJJSA-N |
| XLogP | 10.52 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.93 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|