C27H31N5O2 — CID 137167471
1-[3-(benzotriazol-2-yl)-2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]-3-phenylurea (PubChem CID 137167471) has the molecular formula C27H31N5O2 and a molecular weight of 457.58 g/mol. Its IUPAC name is 1-[3-(benzotriazol-2-yl)-2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]-3-phenylurea.
| Compound Name | 1-[3-(benzotriazol-2-yl)-2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 137167471 |
| Molecular Formula | C27H31N5O2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 1-[3-(benzotriazol-2-yl)-2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]-3-phenylurea |
| SMILES | CC(C)(C)CC(C)(C)c1cc(NC(=O)Nc2ccccc2)c(O)c(-n2nc3ccccc3n2)c1 |
| InChI | InChI=1S/C27H31N5O2/c1-26(2,3)17-27(4,5)18-15-22(29-25(34)28-19-11-7-6-8-12-19)24(33)23(16-18)32-30-20-13-9-10-14-21(20)31-32/h6-16,33H,17H2,1-5H3,(H2,28,29,34) |
| InChIKey | NZPOPGUXPPPGNL-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|