C26H29N5O2 — CID 139814813
1-[2-hydroxy-3-(5-methylbenzotriazol-2-yl)-5-(2-methylbutan-2-yl)phenyl]-3-(4-methylphenyl)urea (PubChem CID 139814813) has the molecular formula C26H29N5O2 and a molecular weight of 443.55 g/mol. Its IUPAC name is 1-[2-hydroxy-3-(5-methylbenzotriazol-2-yl)-5-(2-methylbutan-2-yl)phenyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[2-hydroxy-3-(5-methylbenzotriazol-2-yl)-5-(2-methylbutan-2-yl)phenyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 139814813 |
| Molecular Formula | C26H29N5O2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 1-[2-hydroxy-3-(5-methylbenzotriazol-2-yl)-5-(2-methylbutan-2-yl)phenyl]-3-(4-methylphenyl)urea |
| SMILES | CCC(C)(C)c1cc(NC(=O)Nc2ccc(C)cc2)c(O)c(-n2nc3ccc(C)cc3n2)c1 |
| InChI | InChI=1S/C26H29N5O2/c1-6-26(4,5)18-14-22(28-25(33)27-19-10-7-16(2)8-11-19)24(32)23(15-18)31-29-20-12-9-17(3)13-21(20)30-31/h7-15,32H,6H2,1-5H3,(H2,27,28,33) |
| InChIKey | PYWCWEUTGMMDJQ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|