C27H36ClN5O2 — CID 139814795
1-[3-(5-chlorobenzotriazol-2-yl)-2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]-3-cyclohexylurea (PubChem CID 139814795) has the molecular formula C27H36ClN5O2 and a molecular weight of 498.07 g/mol. Its IUPAC name is 1-[3-(5-chlorobenzotriazol-2-yl)-2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]-3-cyclohexylurea.
| Compound Name | 1-[3-(5-chlorobenzotriazol-2-yl)-2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 139814795 |
| Molecular Formula | C27H36ClN5O2 |
| Molecular Weight | 498.07 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 1-[3-(5-chlorobenzotriazol-2-yl)-2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]-3-cyclohexylurea |
| SMILES | CC(C)(C)CC(C)(C)c1cc(NC(=O)NC2CCCCC2)c(O)c(-n2nc3ccc(Cl)cc3n2)c1 |
| InChI | InChI=1S/C27H36ClN5O2/c1-26(2,3)16-27(4,5)17-13-22(30-25(35)29-19-9-7-6-8-10-19)24(34)23(14-17)33-31-20-12-11-18(28)15-21(20)32-33/h11-15,19,34H,6-10,16H2,1-5H3,(H2,29,30,35) |
| InChIKey | YDZPEIQJVOMEQV-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.07 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|