C21H23N3O3 — CID 163901853
1-[2-[2-hydroxy-5-(2-methylbutan-2-yl)phenyl]benzotriazol-5-yl]butane-1,2-dione (PubChem CID 163901853) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 1-[2-[2-hydroxy-5-(2-methylbutan-2-yl)phenyl]benzotriazol-5-yl]butane-1,2-dione.
| Compound Name | 1-[2-[2-hydroxy-5-(2-methylbutan-2-yl)phenyl]benzotriazol-5-yl]butane-1,2-dione |
|---|---|
| PubChem CID | 163901853 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 1-[2-[2-hydroxy-5-(2-methylbutan-2-yl)phenyl]benzotriazol-5-yl]butane-1,2-dione |
| SMILES | CCC(=O)C(=O)c1ccc2nn(-c3cc(C(C)(C)CC)ccc3O)nc2c1 |
| InChI | InChI=1S/C21H23N3O3/c1-5-18(25)20(27)13-7-9-15-16(11-13)23-24(22-15)17-12-14(8-10-19(17)26)21(3,4)6-2/h7-12,26H,5-6H2,1-4H3 |
| InChIKey | QKNOABISRXGOBV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|