C26H35N3O3 — CID 14298379
butyl 2-[3-butyl-2-hydroxy-5-(2-methylbutan-2-yl)phenyl]benzotriazole-5-carboxylate (PubChem CID 14298379) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is butyl 2-[3-butyl-2-hydroxy-5-(2-methylbutan-2-yl)phenyl]benzotriazole-5-carboxylate.
| Compound Name | butyl 2-[3-butyl-2-hydroxy-5-(2-methylbutan-2-yl)phenyl]benzotriazole-5-carboxylate |
|---|---|
| PubChem CID | 14298379 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | butyl 2-[3-butyl-2-hydroxy-5-(2-methylbutan-2-yl)phenyl]benzotriazole-5-carboxylate |
| SMILES | CCCCOC(=O)c1ccc2nn(-c3cc(C(C)(C)CC)cc(CCCC)c3O)nc2c1 |
| InChI | InChI=1S/C26H35N3O3/c1-6-9-11-18-15-20(26(4,5)8-3)17-23(24(18)30)29-27-21-13-12-19(16-22(21)28-29)25(31)32-14-10-7-2/h12-13,15-17,30H,6-11,14H2,1-5H3 |
| InChIKey | ZYHKHEGTDPOTQN-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|