C22H27N3O2 — CID 155928241
3-[3-(benzotriazol-2-yl)-2-hydroxy-5-(2-methylbutan-2-yl)phenyl]-3-methylbutan-2-one (PubChem CID 155928241) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 3-[3-(benzotriazol-2-yl)-2-hydroxy-5-(2-methylbutan-2-yl)phenyl]-3-methylbutan-2-one.
| Compound Name | 3-[3-(benzotriazol-2-yl)-2-hydroxy-5-(2-methylbutan-2-yl)phenyl]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 155928241 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 3-[3-(benzotriazol-2-yl)-2-hydroxy-5-(2-methylbutan-2-yl)phenyl]-3-methylbutan-2-one |
| SMILES | CCC(C)(C)c1cc(-n2nc3ccccc3n2)c(O)c(C(C)(C)C(C)=O)c1 |
| InChI | InChI=1S/C22H27N3O2/c1-7-21(3,4)15-12-16(22(5,6)14(2)26)20(27)19(13-15)25-23-17-10-8-9-11-18(17)24-25/h8-13,27H,7H2,1-6H3 |
| InChIKey | HVYZXBKVAMLOKP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |