C27H37N3O — CID 141176247
2,4-bis(2-methylbutan-2-yl)-6-[4-(3-phenylpropyl)triazol-2-yl]phenol (PubChem CID 141176247) has the molecular formula C27H37N3O and a molecular weight of 419.61 g/mol. Its IUPAC name is 2,4-bis(2-methylbutan-2-yl)-6-[4-(3-phenylpropyl)triazol-2-yl]phenol.
| Compound Name | 2,4-bis(2-methylbutan-2-yl)-6-[4-(3-phenylpropyl)triazol-2-yl]phenol |
|---|---|
| PubChem CID | 141176247 |
| Molecular Formula | C27H37N3O |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.29 |
| IUPAC Name | 2,4-bis(2-methylbutan-2-yl)-6-[4-(3-phenylpropyl)triazol-2-yl]phenol |
| SMILES | CCC(C)(C)c1cc(-n2ncc(CCCc3ccccc3)n2)c(O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C27H37N3O/c1-7-26(3,4)21-17-23(27(5,6)8-2)25(31)24(18-21)30-28-19-22(29-30)16-12-15-20-13-10-9-11-14-20/h9-11,13-14,17-19,31H,7-8,12,15-16H2,1-6H3 |
| InChIKey | GJGVBRQZAZNXKK-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |