C34H37N3O — CID 18515457
2-(benzotriazol-2-yl)-4,6-bis(3-phenylpentan-3-yl)phenol (PubChem CID 18515457) has the molecular formula C34H37N3O and a molecular weight of 503.69 g/mol. Its IUPAC name is 2-(benzotriazol-2-yl)-4,6-bis(3-phenylpentan-3-yl)phenol.
| Compound Name | 2-(benzotriazol-2-yl)-4,6-bis(3-phenylpentan-3-yl)phenol |
|---|---|
| PubChem CID | 18515457 |
| Molecular Formula | C34H37N3O |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.29 |
| IUPAC Name | 2-(benzotriazol-2-yl)-4,6-bis(3-phenylpentan-3-yl)phenol |
| SMILES | CCC(CC)(c1ccccc1)c1cc(-n2nc3ccccc3n2)c(O)c(C(CC)(CC)c2ccccc2)c1 |
| InChI | InChI=1S/C34H37N3O/c1-5-33(6-2,25-17-11-9-12-18-25)27-23-28(34(7-3,8-4)26-19-13-10-14-20-26)32(38)31(24-27)37-35-29-21-15-16-22-30(29)36-37/h9-24,38H,5-8H2,1-4H3 |
| InChIKey | LVVABMPCSXLBTF-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |