C26H29N3O — CID 70822245
2-(benzotriazol-2-yl)-4-pentyl-6-(2-phenylpropan-2-yl)phenol (PubChem CID 70822245) has the molecular formula C26H29N3O and a molecular weight of 399.54 g/mol. Its IUPAC name is 2-(benzotriazol-2-yl)-4-pentyl-6-(2-phenylpropan-2-yl)phenol.
| Compound Name | 2-(benzotriazol-2-yl)-4-pentyl-6-(2-phenylpropan-2-yl)phenol |
|---|---|
| PubChem CID | 70822245 |
| Molecular Formula | C26H29N3O |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 2-(benzotriazol-2-yl)-4-pentyl-6-(2-phenylpropan-2-yl)phenol |
| SMILES | CCCCCc1cc(-n2nc3ccccc3n2)c(O)c(C(C)(C)c2ccccc2)c1 |
| InChI | InChI=1S/C26H29N3O/c1-4-5-7-12-19-17-21(26(2,3)20-13-8-6-9-14-20)25(30)24(18-19)29-27-22-15-10-11-16-23(22)28-29/h6,8-11,13-18,30H,4-5,7,12H2,1-3H3 |
| InChIKey | UESCXOOHIXTFHS-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|