C24H23N3O5S — CID 139839177
3-[5-(benzenesulfonyl)benzotriazol-2-yl]-4-hydroxy-5-(2-methylbutan-2-yl)benzoic acid (PubChem CID 139839177) has the molecular formula C24H23N3O5S and a molecular weight of 465.53 g/mol. Its IUPAC name is 3-[5-(benzenesulfonyl)benzotriazol-2-yl]-4-hydroxy-5-(2-methylbutan-2-yl)benzoic acid.
| Compound Name | 3-[5-(benzenesulfonyl)benzotriazol-2-yl]-4-hydroxy-5-(2-methylbutan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 139839177 |
| Molecular Formula | C24H23N3O5S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 3-[5-(benzenesulfonyl)benzotriazol-2-yl]-4-hydroxy-5-(2-methylbutan-2-yl)benzoic acid |
| SMILES | CCC(C)(C)c1cc(C(=O)O)cc(-n2nc3ccc(S(=O)(=O)c4ccccc4)cc3n2)c1O |
| InChI | InChI=1S/C24H23N3O5S/c1-4-24(2,3)18-12-15(23(29)30)13-21(22(18)28)27-25-19-11-10-17(14-20(19)26-27)33(31,32)16-8-6-5-7-9-16/h5-14,28H,4H2,1-3H3,(H,29,30) |
| InChIKey | WOLXSTMMMYHABD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |