C26H27N5O4S — CID 139838978
2-[3-[5-(benzenesulfonyl)benzotriazol-2-yl]-5-cyclohexyl-4-hydroxyphenyl]acetohydrazide (PubChem CID 139838978) has the molecular formula C26H27N5O4S and a molecular weight of 505.60 g/mol. Its IUPAC name is 2-[3-[5-(benzenesulfonyl)benzotriazol-2-yl]-5-cyclohexyl-4-hydroxyphenyl]acetohydrazide.
| Compound Name | 2-[3-[5-(benzenesulfonyl)benzotriazol-2-yl]-5-cyclohexyl-4-hydroxyphenyl]acetohydrazide |
|---|---|
| PubChem CID | 139838978 |
| Molecular Formula | C26H27N5O4S |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 2-[3-[5-(benzenesulfonyl)benzotriazol-2-yl]-5-cyclohexyl-4-hydroxyphenyl]acetohydrazide |
| SMILES | NNC(=O)Cc1cc(C2CCCCC2)c(O)c(-n2nc3ccc(S(=O)(=O)c4ccccc4)cc3n2)c1 |
| InChI | InChI=1S/C26H27N5O4S/c27-28-25(32)15-17-13-21(18-7-3-1-4-8-18)26(33)24(14-17)31-29-22-12-11-20(16-23(22)30-31)36(34,35)19-9-5-2-6-10-19/h2,5-6,9-14,16,18,33H,1,3-4,7-8,15,27H2,(H,28,32) |
| InChIKey | JXIGVJSXKJSUDE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 140.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|