C41H57N3O4S — CID 139930512
octyl 3-[3-[5-(benzenesulfonyl)benzotriazol-2-yl]-5-tert-butyl-4-octylphenyl]propanoate (PubChem CID 139930512) has the molecular formula C41H57N3O4S and a molecular weight of 687.99 g/mol. Its IUPAC name is octyl 3-[3-[5-(benzenesulfonyl)benzotriazol-2-yl]-5-tert-butyl-4-octylphenyl]propanoate.
| Compound Name | octyl 3-[3-[5-(benzenesulfonyl)benzotriazol-2-yl]-5-tert-butyl-4-octylphenyl]propanoate |
|---|---|
| PubChem CID | 139930512 |
| Molecular Formula | C41H57N3O4S |
| Molecular Weight | 687.99 g/mol |
| Exact Mass | 687.41 |
| IUPAC Name | octyl 3-[3-[5-(benzenesulfonyl)benzotriazol-2-yl]-5-tert-butyl-4-octylphenyl]propanoate |
| SMILES | CCCCCCCCOC(=O)CCc1cc(-n2nc3ccc(S(=O)(=O)c4ccccc4)cc3n2)c(CCCCCCCC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C41H57N3O4S/c1-6-8-10-12-14-19-23-35-36(41(3,4)5)29-32(24-27-40(45)48-28-20-15-13-11-9-7-2)30-39(35)44-42-37-26-25-34(31-38(37)43-44)49(46,47)33-21-17-16-18-22-33/h16-18,21-22,25-26,29-31H,6-15,19-20,23-24,27-28H2,1-5H3 |
| InChIKey | NHGHSIGKLZKASL-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.99 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|