C23H35N3O3 — CID 175160926
octyl 3-[3-tert-butyl-4-hydroxy-5-(triazol-2-yl)phenyl]propanoate (PubChem CID 175160926) has the molecular formula C23H35N3O3 and a molecular weight of 401.55 g/mol. Its IUPAC name is octyl 3-[3-tert-butyl-4-hydroxy-5-(triazol-2-yl)phenyl]propanoate.
| Compound Name | octyl 3-[3-tert-butyl-4-hydroxy-5-(triazol-2-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 175160926 |
| Molecular Formula | C23H35N3O3 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | octyl 3-[3-tert-butyl-4-hydroxy-5-(triazol-2-yl)phenyl]propanoate |
| SMILES | CCCCCCCCOC(=O)CCc1cc(-n2nccn2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H35N3O3/c1-5-6-7-8-9-10-15-29-21(27)12-11-18-16-19(23(2,3)4)22(28)20(17-18)26-24-13-14-25-26/h13-14,16-17,28H,5-12,15H2,1-4H3 |
| InChIKey | RUYKAKPEBIIKBL-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|