C27H37N3O4 — CID 151706336
octyl 3-[3-(benzotriazol-2-yl)-5-tert-butyl-4-hydroperoxyphenyl]propanoate (PubChem CID 151706336) has the molecular formula C27H37N3O4 and a molecular weight of 467.61 g/mol. Its IUPAC name is octyl 3-[3-(benzotriazol-2-yl)-5-tert-butyl-4-hydroperoxyphenyl]propanoate.
| Compound Name | octyl 3-[3-(benzotriazol-2-yl)-5-tert-butyl-4-hydroperoxyphenyl]propanoate |
|---|---|
| PubChem CID | 151706336 |
| Molecular Formula | C27H37N3O4 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | octyl 3-[3-(benzotriazol-2-yl)-5-tert-butyl-4-hydroperoxyphenyl]propanoate |
| SMILES | CCCCCCCCOC(=O)CCc1cc(-n2nc3ccccc3n2)c(OO)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H37N3O4/c1-5-6-7-8-9-12-17-33-25(31)16-15-20-18-21(27(2,3)4)26(34-32)24(19-20)30-28-22-13-10-11-14-23(22)29-30/h10-11,13-14,18-19,32H,5-9,12,15-17H2,1-4H3 |
| InChIKey | RFQVMZJAMXBQMS-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|