C29H35N5O4S — CID 139839046
3-[3-[5-(benzenesulfonyl)benzotriazol-2-yl]-4-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]propanehydrazide (PubChem CID 139839046) has the molecular formula C29H35N5O4S and a molecular weight of 549.70 g/mol. Its IUPAC name is 3-[3-[5-(benzenesulfonyl)benzotriazol-2-yl]-4-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]propanehydrazide.
| Compound Name | 3-[3-[5-(benzenesulfonyl)benzotriazol-2-yl]-4-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]propanehydrazide |
|---|---|
| PubChem CID | 139839046 |
| Molecular Formula | C29H35N5O4S |
| Molecular Weight | 549.70 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | 3-[3-[5-(benzenesulfonyl)benzotriazol-2-yl]-4-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]propanehydrazide |
| SMILES | CC(C)(C)CC(C)(C)c1cc(CCC(=O)NN)cc(-n2nc3ccc(S(=O)(=O)c4ccccc4)cc3n2)c1O |
| InChI | InChI=1S/C29H35N5O4S/c1-28(2,3)18-29(4,5)22-15-19(11-14-26(35)31-30)16-25(27(22)36)34-32-23-13-12-21(17-24(23)33-34)39(37,38)20-9-7-6-8-10-20/h6-10,12-13,15-17,36H,11,14,18,30H2,1-5H3,(H,31,35) |
| InChIKey | MFVINLNBTFCTJP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 140.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.70 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|