C24H25N5O4S — CID 139838888
3-[5-(benzenesulfonyl)benzotriazol-2-yl]-4-hydroxy-5-(2-methylbutan-2-yl)benzohydrazide (PubChem CID 139838888) has the molecular formula C24H25N5O4S and a molecular weight of 479.56 g/mol. Its IUPAC name is 3-[5-(benzenesulfonyl)benzotriazol-2-yl]-4-hydroxy-5-(2-methylbutan-2-yl)benzohydrazide.
| Compound Name | 3-[5-(benzenesulfonyl)benzotriazol-2-yl]-4-hydroxy-5-(2-methylbutan-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 139838888 |
| Molecular Formula | C24H25N5O4S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 3-[5-(benzenesulfonyl)benzotriazol-2-yl]-4-hydroxy-5-(2-methylbutan-2-yl)benzohydrazide |
| SMILES | CCC(C)(C)c1cc(C(=O)NN)cc(-n2nc3ccc(S(=O)(=O)c4ccccc4)cc3n2)c1O |
| InChI | InChI=1S/C24H25N5O4S/c1-4-24(2,3)18-12-15(23(31)26-25)13-21(22(18)30)29-27-19-11-10-17(14-20(19)28-29)34(32,33)16-8-6-5-7-9-16/h5-14,30H,4,25H2,1-3H3,(H,26,31) |
| InChIKey | SCYFJFNTUICVBJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 140.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|