C17H17NO3S — CID 59021826
6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalene-1-carboxamide (PubChem CID 59021826) has the molecular formula C17H17NO3S and a molecular weight of 315.39 g/mol. Its IUPAC name is 6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalene-1-carboxamide.
| Compound Name | 6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 59021826 |
| Molecular Formula | C17H17NO3S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalene-1-carboxamide |
| SMILES | NC(=O)C1CCCc2cc(S(=O)(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C17H17NO3S/c18-17(19)16-8-4-5-12-11-14(9-10-15(12)16)22(20,21)13-6-2-1-3-7-13/h1-3,6-7,9-11,16H,4-5,8H2,(H2,18,19) |
| InChIKey | FYEXYFFIQHSUGX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |