C21H25NO2S — CID 143209774
4-[5-(benzenesulfonyl)-2,3-dihydro-1H-inden-1-yl]azepane (PubChem CID 143209774) has the molecular formula C21H25NO2S and a molecular weight of 355.50 g/mol. Its IUPAC name is 4-[5-(benzenesulfonyl)-2,3-dihydro-1H-inden-1-yl]azepane.
| Compound Name | 4-[5-(benzenesulfonyl)-2,3-dihydro-1H-inden-1-yl]azepane |
|---|---|
| PubChem CID | 143209774 |
| Molecular Formula | C21H25NO2S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 4-[5-(benzenesulfonyl)-2,3-dihydro-1H-inden-1-yl]azepane |
| SMILES | O=S(=O)(c1ccccc1)c1ccc2c(c1)CCC2C1CCCNCC1 |
| InChI | InChI=1S/C21H25NO2S/c23-25(24,18-6-2-1-3-7-18)19-9-11-21-17(15-19)8-10-20(21)16-5-4-13-22-14-12-16/h1-3,6-7,9,11,15-16,20,22H,4-5,8,10,12-14H2 |
| InChIKey | VNSPCLXCPVPZEN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |