C15H22N2 — CID 83261284
2-(azepan-4-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 83261284) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 2-(azepan-4-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 2-(azepan-4-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 83261284 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2-(azepan-4-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | c1ccc2c(c1)CCC(C1CCCNCC1)N2 |
| InChI | InChI=1S/C15H22N2/c1-2-6-14-12(4-1)7-8-15(17-14)13-5-3-10-16-11-9-13/h1-2,4,6,13,15-17H,3,5,7-11H2 |
| InChIKey | YHZMLCJXYUJERE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |