C20H21NO3S — CID 140973128
8-(benzenesulfonyl)-1-methyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-3-one (PubChem CID 140973128) has the molecular formula C20H21NO3S and a molecular weight of 355.46 g/mol. Its IUPAC name is 8-(benzenesulfonyl)-1-methyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-3-one.
| Compound Name | 8-(benzenesulfonyl)-1-methyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-3-one |
|---|---|
| PubChem CID | 140973128 |
| Molecular Formula | C20H21NO3S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 8-(benzenesulfonyl)-1-methyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-3-one |
| SMILES | CC1CC(=O)NC2CCc3cc(S(=O)(=O)c4ccccc4)ccc3C12 |
| InChI | InChI=1S/C20H21NO3S/c1-13-11-19(22)21-18-10-7-14-12-16(8-9-17(14)20(13)18)25(23,24)15-5-3-2-4-6-15/h2-6,8-9,12-13,18,20H,7,10-11H2,1H3,(H,21,22) |
| InChIKey | KRYMNRVBFIQYOT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |