C37H41N5O4S2 — CID 123672383
3-[6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-N'-[[6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]-3-(diaminomethylideneamino)propanimidamide (PubChem CID 123672383) has the molecular formula C37H41N5O4S2 and a molecular weight of 683.90 g/mol. Its IUPAC name is 3-[6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-N'-[[6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]-3-(diaminomethylideneamino)propanimidamide.
| Compound Name | 3-[6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-N'-[[6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]-3-(diaminomethylideneamino)propanimidamide |
|---|---|
| PubChem CID | 123672383 |
| Molecular Formula | C37H41N5O4S2 |
| Molecular Weight | 683.90 g/mol |
| Exact Mass | 683.26 |
| IUPAC Name | 3-[6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-N'-[[6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]-3-(diaminomethylideneamino)propanimidamide |
| SMILES | NC(N)=NC(C/C(N)=N/CC1CCCc2cc(S(=O)(=O)c3ccccc3)ccc21)C1CCCc2cc(S(=O)(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C37H41N5O4S2/c38-36(41-24-27-11-7-9-25-21-30(17-19-32(25)27)47(43,44)28-12-3-1-4-13-28)23-35(42-37(39)40)34-16-8-10-26-22-31(18-20-33(26)34)48(45,46)29-14-5-2-6-15-29/h1-6,12-15,17-22,27,34-35H,7-11,16,23-24H2,(H2,38,41)(H4,39,40,42) |
| InChIKey | BBZPZTSWHJWGRA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 171.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.90 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|