C19H19FN4O2S — CID 59021714
1-cyano-2-[[(1R)-6-(2-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]guanidine (PubChem CID 59021714) has the molecular formula C19H19FN4O2S and a molecular weight of 386.45 g/mol. Its IUPAC name is 1-cyano-2-[[(1R)-6-(2-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]guanidine.
| Compound Name | 1-cyano-2-[[(1R)-6-(2-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]guanidine |
|---|---|
| PubChem CID | 59021714 |
| Molecular Formula | C19H19FN4O2S |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 1-cyano-2-[[(1R)-6-(2-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]guanidine |
| SMILES | N#CN/C(N)=N/C[C@@H]1CCCc2cc(S(=O)(=O)c3ccccc3F)ccc21 |
| InChI | InChI=1S/C19H19FN4O2S/c20-17-6-1-2-7-18(17)27(25,26)15-8-9-16-13(10-15)4-3-5-14(16)11-23-19(22)24-12-21/h1-2,6-10,14H,3-5,11H2,(H3,22,23,24)/t14-/m0/s1 |
| InChIKey | FUFJBZCOEVVFIS-AWEZNQCLSA-N |
| XLogP | 2.46 |
| TPSA | 108.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|