C21H27N3O2S — CID 68836798
N'-[[6-(benzenesulfonamido)-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]-N,N-dimethylethanimidamide (PubChem CID 68836798) has the molecular formula C21H27N3O2S and a molecular weight of 385.53 g/mol. Its IUPAC name is N'-[[6-(benzenesulfonamido)-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]-N,N-dimethylethanimidamide.
| Compound Name | N'-[[6-(benzenesulfonamido)-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]-N,N-dimethylethanimidamide |
|---|---|
| PubChem CID | 68836798 |
| Molecular Formula | C21H27N3O2S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N'-[[6-(benzenesulfonamido)-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]-N,N-dimethylethanimidamide |
| SMILES | C/C(=N\CC1CCCc2cc(NS(=O)(=O)c3ccccc3)ccc21)N(C)C |
| InChI | InChI=1S/C21H27N3O2S/c1-16(24(2)3)22-15-18-9-7-8-17-14-19(12-13-21(17)18)23-27(25,26)20-10-5-4-6-11-20/h4-6,10-14,18,23H,7-9,15H2,1-3H3/b22-16+ |
| InChIKey | RZJGHANIDMKOHY-CJLVFECKSA-N |
| XLogP | 3.89 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|