C25H25N3O5S — CID 70139010
3-[3-[5-(benzenesulfonyl)benzotriazol-2-yl]-5-tert-butyl-4-hydroxycyclohexa-2,4-dien-1-yl]prop-2-enoic acid (PubChem CID 70139010) has the molecular formula C25H25N3O5S and a molecular weight of 479.56 g/mol. Its IUPAC name is 3-[3-[5-(benzenesulfonyl)benzotriazol-2-yl]-5-tert-butyl-4-hydroxycyclohexa-2,4-dien-1-yl]prop-2-enoic acid.
| Compound Name | 3-[3-[5-(benzenesulfonyl)benzotriazol-2-yl]-5-tert-butyl-4-hydroxycyclohexa-2,4-dien-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 70139010 |
| Molecular Formula | C25H25N3O5S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 3-[3-[5-(benzenesulfonyl)benzotriazol-2-yl]-5-tert-butyl-4-hydroxycyclohexa-2,4-dien-1-yl]prop-2-enoic acid |
| SMILES | CC(C)(C)C1=C(O)C(n2nc3ccc(S(=O)(=O)c4ccccc4)cc3n2)=CC(C=CC(=O)O)C1 |
| InChI | InChI=1S/C25H25N3O5S/c1-25(2,3)19-13-16(9-12-23(29)30)14-22(24(19)31)28-26-20-11-10-18(15-21(20)27-28)34(32,33)17-7-5-4-6-8-17/h4-12,14-16,31H,13H2,1-3H3,(H,29,30) |
| InChIKey | BADYIXUPZQYGPZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|