C33H35N3O3 — CID 162700819
2-[2-hydroxy-3-(2-phenylpropan-2-yl)-5-(2,4,4-trimethylpentan-2-yl)phenyl]benzo[f]benzotriazole-5,8-dione (PubChem CID 162700819) has the molecular formula C33H35N3O3 and a molecular weight of 521.66 g/mol. Its IUPAC name is 2-[2-hydroxy-3-(2-phenylpropan-2-yl)-5-(2,4,4-trimethylpentan-2-yl)phenyl]benzo[f]benzotriazole-5,8-dione.
| Compound Name | 2-[2-hydroxy-3-(2-phenylpropan-2-yl)-5-(2,4,4-trimethylpentan-2-yl)phenyl]benzo[f]benzotriazole-5,8-dione |
|---|---|
| PubChem CID | 162700819 |
| Molecular Formula | C33H35N3O3 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.27 |
| IUPAC Name | 2-[2-hydroxy-3-(2-phenylpropan-2-yl)-5-(2,4,4-trimethylpentan-2-yl)phenyl]benzo[f]benzotriazole-5,8-dione |
| SMILES | CC(C)(C)CC(C)(C)c1cc(-n2nc3cc4c(cc3n2)C(=O)C=CC4=O)c(O)c(C(C)(C)c2ccccc2)c1 |
| InChI | InChI=1S/C33H35N3O3/c1-31(2,3)19-32(4,5)21-15-24(33(6,7)20-11-9-8-10-12-20)30(39)27(16-21)36-34-25-17-22-23(18-26(25)35-36)29(38)14-13-28(22)37/h8-18,39H,19H2,1-7H3 |
| InChIKey | DPBNTZIHXCKZJT-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|