C34H43N3O3 — CID 118443326
[2-(benzotriazol-2-yl)-6-(2-phenylpropan-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenyl] tert-butyl carbonate (PubChem CID 118443326) has the molecular formula C34H43N3O3 and a molecular weight of 541.74 g/mol. Its IUPAC name is [2-(benzotriazol-2-yl)-6-(2-phenylpropan-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenyl] tert-butyl carbonate.
| Compound Name | [2-(benzotriazol-2-yl)-6-(2-phenylpropan-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenyl] tert-butyl carbonate |
|---|---|
| PubChem CID | 118443326 |
| Molecular Formula | C34H43N3O3 |
| Molecular Weight | 541.74 g/mol |
| Exact Mass | 541.33 |
| IUPAC Name | [2-(benzotriazol-2-yl)-6-(2-phenylpropan-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenyl] tert-butyl carbonate |
| SMILES | CC(C)(C)CC(C)(C)c1cc(-n2nc3ccccc3n2)c(OC(=O)OC(C)(C)C)c(C(C)(C)c2ccccc2)c1 |
| InChI | InChI=1S/C34H43N3O3/c1-31(2,3)22-33(7,8)24-20-25(34(9,10)23-16-12-11-13-17-23)29(39-30(38)40-32(4,5)6)28(21-24)37-35-26-18-14-15-19-27(26)36-37/h11-21H,22H2,1-10H3 |
| InChIKey | VBURGRKFBHKPFN-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.74 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|