C25H35N3O2 — CID 135185378
2-[3-butoxy-2-methoxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]benzotriazole (PubChem CID 135185378) has the molecular formula C25H35N3O2 and a molecular weight of 409.57 g/mol. Its IUPAC name is 2-[3-butoxy-2-methoxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]benzotriazole.
| Compound Name | 2-[3-butoxy-2-methoxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]benzotriazole |
|---|---|
| PubChem CID | 135185378 |
| Molecular Formula | C25H35N3O2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | 2-[3-butoxy-2-methoxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]benzotriazole |
| SMILES | CCCCOc1cc(C(C)(C)CC(C)(C)C)cc(-n2nc3ccccc3n2)c1OC |
| InChI | InChI=1S/C25H35N3O2/c1-8-9-14-30-22-16-18(25(5,6)17-24(2,3)4)15-21(23(22)29-7)28-26-19-12-10-11-13-20(19)27-28/h10-13,15-16H,8-9,14,17H2,1-7H3 |
| InChIKey | ACHURIRSLBLQMA-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|