C26H35N3O3 — CID 20702877
tert-butyl [2-(5-methylbenzotriazol-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenyl] carbonate (PubChem CID 20702877) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is tert-butyl [2-(5-methylbenzotriazol-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenyl] carbonate.
| Compound Name | tert-butyl [2-(5-methylbenzotriazol-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenyl] carbonate |
|---|---|
| PubChem CID | 20702877 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | tert-butyl [2-(5-methylbenzotriazol-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenyl] carbonate |
| SMILES | Cc1ccc2nn(-c3cc(C(C)(C)CC(C)(C)C)ccc3OC(=O)OC(C)(C)C)nc2c1 |
| InChI | InChI=1S/C26H35N3O3/c1-17-10-12-19-20(14-17)28-29(27-19)21-15-18(26(8,9)16-24(2,3)4)11-13-22(21)31-23(30)32-25(5,6)7/h10-15H,16H2,1-9H3 |
| InChIKey | URIBGPXHKYWUPR-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|