C32H36N6O4 — CID 20702912
[2,5-bis(5-tert-butylbenzotriazol-2-yl)-4-formylphenyl] tert-butyl carbonate (PubChem CID 20702912) has the molecular formula C32H36N6O4 and a molecular weight of 568.68 g/mol. Its IUPAC name is [2,5-bis(5-tert-butylbenzotriazol-2-yl)-4-formylphenyl] tert-butyl carbonate.
| Compound Name | [2,5-bis(5-tert-butylbenzotriazol-2-yl)-4-formylphenyl] tert-butyl carbonate |
|---|---|
| PubChem CID | 20702912 |
| Molecular Formula | C32H36N6O4 |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.28 |
| IUPAC Name | [2,5-bis(5-tert-butylbenzotriazol-2-yl)-4-formylphenyl] tert-butyl carbonate |
| SMILES | CC(C)(C)OC(=O)Oc1cc(-n2nc3ccc(C(C)(C)C)cc3n2)c(C=O)cc1-n1nc2ccc(C(C)(C)C)cc2n1 |
| InChI | InChI=1S/C32H36N6O4/c1-30(2,3)20-10-12-22-24(15-20)35-37(33-22)26-17-28(41-29(40)42-32(7,8)9)27(14-19(26)18-39)38-34-23-13-11-21(31(4,5)6)16-25(23)36-38/h10-18H,1-9H3 |
| InChIKey | MHCJPFIXCMGSMD-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 114.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|