C25H27N5O2 — CID 139814834
1-[5-tert-butyl-2-hydroxy-3-(5-methylbenzotriazol-2-yl)phenyl]-3-(3-methylphenyl)urea (PubChem CID 139814834) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is 1-[5-tert-butyl-2-hydroxy-3-(5-methylbenzotriazol-2-yl)phenyl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[5-tert-butyl-2-hydroxy-3-(5-methylbenzotriazol-2-yl)phenyl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 139814834 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 1-[5-tert-butyl-2-hydroxy-3-(5-methylbenzotriazol-2-yl)phenyl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)Nc2cc(C(C)(C)C)cc(-n3nc4ccc(C)cc4n3)c2O)c1 |
| InChI | InChI=1S/C25H27N5O2/c1-15-7-6-8-18(11-15)26-24(32)27-21-13-17(25(3,4)5)14-22(23(21)31)30-28-19-10-9-16(2)12-20(19)29-30/h6-14,31H,1-5H3,(H2,26,27,32) |
| InChIKey | QOOZVEUSHGOFAJ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|