C26H34N4O2 — CID 102001722
N-[[3-(benzotriazol-2-yl)-2-hydroxy-5-(2-methylheptan-2-yl)phenyl]methyl]-N,2-dimethylprop-2-enamide (PubChem CID 102001722) has the molecular formula C26H34N4O2 and a molecular weight of 434.58 g/mol. Its IUPAC name is N-[[3-(benzotriazol-2-yl)-2-hydroxy-5-(2-methylheptan-2-yl)phenyl]methyl]-N,2-dimethylprop-2-enamide.
| Compound Name | N-[[3-(benzotriazol-2-yl)-2-hydroxy-5-(2-methylheptan-2-yl)phenyl]methyl]-N,2-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 102001722 |
| Molecular Formula | C26H34N4O2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | N-[[3-(benzotriazol-2-yl)-2-hydroxy-5-(2-methylheptan-2-yl)phenyl]methyl]-N,2-dimethylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(C)Cc1cc(C(C)(C)CCCCC)cc(-n2nc3ccccc3n2)c1O |
| InChI | InChI=1S/C26H34N4O2/c1-7-8-11-14-26(4,5)20-15-19(17-29(6)25(32)18(2)3)24(31)23(16-20)30-27-21-12-9-10-13-22(21)28-30/h9-10,12-13,15-16,31H,2,7-8,11,14,17H2,1,3-6H3 |
| InChIKey | DQUDQICYCLXKRJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|