C31H39N3O3S — CID 87935163
2-[2-(benzotriazol-2-yl)-4-(2-methylheptan-2-yl)-6-pentylphenyl]benzenesulfonic acid (PubChem CID 87935163) has the molecular formula C31H39N3O3S and a molecular weight of 533.74 g/mol. Its IUPAC name is 2-[2-(benzotriazol-2-yl)-4-(2-methylheptan-2-yl)-6-pentylphenyl]benzenesulfonic acid.
| Compound Name | 2-[2-(benzotriazol-2-yl)-4-(2-methylheptan-2-yl)-6-pentylphenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 87935163 |
| Molecular Formula | C31H39N3O3S |
| Molecular Weight | 533.74 g/mol |
| Exact Mass | 533.27 |
| IUPAC Name | 2-[2-(benzotriazol-2-yl)-4-(2-methylheptan-2-yl)-6-pentylphenyl]benzenesulfonic acid |
| SMILES | CCCCCc1cc(C(C)(C)CCCCC)cc(-n2nc3ccccc3n2)c1-c1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C31H39N3O3S/c1-5-7-9-15-23-21-24(31(3,4)20-14-8-6-2)22-28(34-32-26-17-11-12-18-27(26)33-34)30(23)25-16-10-13-19-29(25)38(35,36)37/h10-13,16-19,21-22H,5-9,14-15,20H2,1-4H3,(H,35,36,37) |
| InChIKey | MDOQHZNPDCGXPR-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.74 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|