C26H29N3O3S — CID 19371834
2-[2-(benzotriazol-2-yl)-4-(2-methylheptan-2-yl)phenyl]benzenesulfonic acid (PubChem CID 19371834) has the molecular formula C26H29N3O3S and a molecular weight of 463.60 g/mol. Its IUPAC name is 2-[2-(benzotriazol-2-yl)-4-(2-methylheptan-2-yl)phenyl]benzenesulfonic acid.
| Compound Name | 2-[2-(benzotriazol-2-yl)-4-(2-methylheptan-2-yl)phenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 19371834 |
| Molecular Formula | C26H29N3O3S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 2-[2-(benzotriazol-2-yl)-4-(2-methylheptan-2-yl)phenyl]benzenesulfonic acid |
| SMILES | CCCCCC(C)(C)c1ccc(-c2ccccc2S(=O)(=O)O)c(-n2nc3ccccc3n2)c1 |
| InChI | InChI=1S/C26H29N3O3S/c1-4-5-10-17-26(2,3)19-15-16-20(21-11-6-9-14-25(21)33(30,31)32)24(18-19)29-27-22-12-7-8-13-23(22)28-29/h6-9,11-16,18H,4-5,10,17H2,1-3H3,(H,30,31,32) |
| InChIKey | MMHPJKSOTFRHRI-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|