C9H15NO — CID 142154446
7-methyl-1,2,3,5,8,8a-hexahydroindolizin-2-ol (PubChem CID 142154446) has the molecular formula C9H15NO and a molecular weight of 153.23 g/mol. Its IUPAC name is 7-methyl-1,2,3,5,8,8a-hexahydroindolizin-2-ol.
| Compound Name | 7-methyl-1,2,3,5,8,8a-hexahydroindolizin-2-ol |
|---|---|
| PubChem CID | 142154446 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 7-methyl-1,2,3,5,8,8a-hexahydroindolizin-2-ol |
| SMILES | CC1=CCN2CC(O)CC2C1 |
| InChI | InChI=1S/C9H15NO/c1-7-2-3-10-6-9(11)5-8(10)4-7/h2,8-9,11H,3-6H2,1H3 |
| InChIKey | SGUHEHAHHBADJV-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|