C30H31Cl2N2OP — CID 142155920
7-(1-tert-butylpiperidin-4-yl)-1-(2,6-dichlorophenyl)-5-(3-phosphanylphenyl)quinolin-2-one (PubChem CID 142155920) has the molecular formula C30H31Cl2N2OP and a molecular weight of 537.47 g/mol. Its IUPAC name is 7-(1-tert-butylpiperidin-4-yl)-1-(2,6-dichlorophenyl)-5-(3-phosphanylphenyl)quinolin-2-one.
| Compound Name | 7-(1-tert-butylpiperidin-4-yl)-1-(2,6-dichlorophenyl)-5-(3-phosphanylphenyl)quinolin-2-one |
|---|---|
| PubChem CID | 142155920 |
| Molecular Formula | C30H31Cl2N2OP |
| Molecular Weight | 537.47 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | 7-(1-tert-butylpiperidin-4-yl)-1-(2,6-dichlorophenyl)-5-(3-phosphanylphenyl)quinolin-2-one |
| SMILES | CC(C)(C)N1CCC(c2cc(-c3cccc(P)c3)c3ccc(=O)n(-c4c(Cl)cccc4Cl)c3c2)CC1 |
| InChI | InChI=1S/C30H31Cl2N2OP/c1-30(2,3)33-14-12-19(13-15-33)21-17-24(20-6-4-7-22(36)16-20)23-10-11-28(35)34(27(23)18-21)29-25(31)8-5-9-26(29)32/h4-11,16-19H,12-15,36H2,1-3H3 |
| InChIKey | GGOPUBMFASVLNJ-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.47 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|