C27H38N2O3 — CID 142157595
butane;cumene;2-methyl-6-(3,4,5-trimethoxyphenyl)pyrazine (PubChem CID 142157595) has the molecular formula C27H38N2O3 and a molecular weight of 438.61 g/mol. Its IUPAC name is butane;cumene;2-methyl-6-(3,4,5-trimethoxyphenyl)pyrazine.
| Compound Name | butane;cumene;2-methyl-6-(3,4,5-trimethoxyphenyl)pyrazine |
|---|---|
| PubChem CID | 142157595 |
| Molecular Formula | C27H38N2O3 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | butane;cumene;2-methyl-6-(3,4,5-trimethoxyphenyl)pyrazine |
| SMILES | CC(C)c1ccccc1.CCCC.COc1cc(-c2cncc(C)n2)cc(OC)c1OC |
| InChI | InChI=1S/C14H16N2O3.C9H12.C4H10/c1-9-7-15-8-11(16-9)10-5-12(17-2)14(19-4)13(6-10)18-3;1-8(2)9-6-4-3-5-7-9;1-3-4-2/h5-8H,1-4H3;3-8H,1-2H3;3-4H2,1-2H3 |
| InChIKey | YBGPXDISYDITCV-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |