C15H24I2S2 — CID 142159901
[(E)-5-iodosulfanyl-3-methyl-1-(2,6,6-trimethylcyclohexen-1-yl)pent-3-enyl] thiohypoiodite (PubChem CID 142159901) has the molecular formula C15H24I2S2 and a molecular weight of 522.30 g/mol. Its IUPAC name is [(E)-5-iodosulfanyl-3-methyl-1-(2,6,6-trimethylcyclohexen-1-yl)pent-3-enyl] thiohypoiodite.
| Compound Name | [(E)-5-iodosulfanyl-3-methyl-1-(2,6,6-trimethylcyclohexen-1-yl)pent-3-enyl] thiohypoiodite |
|---|---|
| PubChem CID | 142159901 |
| Molecular Formula | C15H24I2S2 |
| Molecular Weight | 522.30 g/mol |
| Exact Mass | 521.94 |
| IUPAC Name | [(E)-5-iodosulfanyl-3-methyl-1-(2,6,6-trimethylcyclohexen-1-yl)pent-3-enyl] thiohypoiodite |
| SMILES | CC1=C(C(C/C(C)=C/CSI)SI)C(C)(C)CCC1 |
| InChI | InChI=1S/C15H24I2S2/c1-11(7-9-18-16)10-13(19-17)14-12(2)6-5-8-15(14,3)4/h7,13H,5-6,8-10H2,1-4H3/b11-7+ |
| InChIKey | YYZUMUZMCXEBLV-YRNVUSSQSA-N |
| XLogP | 7.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.30 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|