C27H40O4S — CID 70169338
3,7-dimethyl-9-(4-methylphenyl)sulfonyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-diene-1,5-diol (PubChem CID 70169338) has the molecular formula C27H40O4S and a molecular weight of 460.68 g/mol. Its IUPAC name is 3,7-dimethyl-9-(4-methylphenyl)sulfonyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-diene-1,5-diol.
| Compound Name | 3,7-dimethyl-9-(4-methylphenyl)sulfonyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-diene-1,5-diol |
|---|---|
| PubChem CID | 70169338 |
| Molecular Formula | C27H40O4S |
| Molecular Weight | 460.68 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 3,7-dimethyl-9-(4-methylphenyl)sulfonyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-diene-1,5-diol |
| SMILES | CC(=CCO)CC(O)C=C(C)CC(C1=C(C)CCCC1(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H40O4S/c1-19-9-11-24(12-10-19)32(30,31)25(26-22(4)8-7-14-27(26,5)6)18-21(3)17-23(29)16-20(2)13-15-28/h9-13,17,23,25,28-29H,7-8,14-16,18H2,1-6H3 |
| InChIKey | PZZXGHWYEHUFSX-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.68 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|