C22H29BO3S — CID 88999479
CID 88999479 (PubChem CID 88999479) has the molecular formula C22H29BO3S and a molecular weight of 384.35 g/mol.
| Compound Name | CID 88999479 |
|---|---|
| PubChem CID | 88999479 |
| Molecular Formula | C22H29BO3S |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | — |
| SMILES | [B]C/C=C(\C)CC(C1=C(C)C(=O)CCC1(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H29BO3S/c1-15-6-8-18(9-7-15)27(25,26)20(14-16(2)11-13-23)21-17(3)19(24)10-12-22(21,4)5/h6-9,11,20H,10,12-14H2,1-5H3/b16-11+ |
| InChIKey | OYLRBQCKEOXHNV-LFIBNONCSA-N |
| XLogP | 4.77 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|