C19H25N5 — CID 142160122
6-N-[(3Z)-4-(propylamino)penta-1,3-dien-2-yl]-2-N-(pyridin-3-ylmethyl)pyridine-2,6-diamine (PubChem CID 142160122) has the molecular formula C19H25N5 and a molecular weight of 323.44 g/mol. Its IUPAC name is 6-N-[(3Z)-4-(propylamino)penta-1,3-dien-2-yl]-2-N-(pyridin-3-ylmethyl)pyridine-2,6-diamine.
| Compound Name | 6-N-[(3Z)-4-(propylamino)penta-1,3-dien-2-yl]-2-N-(pyridin-3-ylmethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 142160122 |
| Molecular Formula | C19H25N5 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 6-N-[(3Z)-4-(propylamino)penta-1,3-dien-2-yl]-2-N-(pyridin-3-ylmethyl)pyridine-2,6-diamine |
| SMILES | C=C(/C=C(/C)NCCC)Nc1cccc(NCc2cccnc2)n1 |
| InChI | InChI=1S/C19H25N5/c1-4-10-21-15(2)12-16(3)23-19-9-5-8-18(24-19)22-14-17-7-6-11-20-13-17/h5-9,11-13,21H,3-4,10,14H2,1-2H3,(H2,22,23,24)/b15-12- |
| InChIKey | AFLVYDAZUYHBFA-QINSGFPZSA-N |
| XLogP | 3.92 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|