C25H32N4O3 — CID 142160251
1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-3-[4-methyl-2-(methylamino)-3-pyridinyl]but-3-ene-1,2-dione;ethane (PubChem CID 142160251) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-3-[4-methyl-2-(methylamino)-3-pyridinyl]but-3-ene-1,2-dione;ethane.
| Compound Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-3-[4-methyl-2-(methylamino)-3-pyridinyl]but-3-ene-1,2-dione;ethane |
|---|---|
| PubChem CID | 142160251 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-3-[4-methyl-2-(methylamino)-3-pyridinyl]but-3-ene-1,2-dione;ethane |
| SMILES | C=C(C(=O)C(=O)N1CCN(C(=O)c2ccccc2)C[C@H]1C)c1c(C)ccnc1NC.CC |
| InChI | InChI=1S/C23H26N4O3.C2H6/c1-15-10-11-25-21(24-4)19(15)17(3)20(28)23(30)27-13-12-26(14-16(27)2)22(29)18-8-6-5-7-9-18;1-2/h5-11,16H,3,12-14H2,1-2,4H3,(H,24,25);1-2H3/t16-;/m1./s1 |
| InChIKey | JSTRPUJIIKSLTI-PKLMIRHRSA-N |
| XLogP | 3.41 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|