C18H21ClN2 — CID 142164142
4-chloro-N-methyl-2-[(1E)-1-(3,4,5-trimethyl-1H-pyrrol-2-yl)buta-1,3-dien-2-yl]aniline (PubChem CID 142164142) has the molecular formula C18H21ClN2 and a molecular weight of 300.83 g/mol. Its IUPAC name is 4-chloro-N-methyl-2-[(1E)-1-(3,4,5-trimethyl-1H-pyrrol-2-yl)buta-1,3-dien-2-yl]aniline.
| Compound Name | 4-chloro-N-methyl-2-[(1E)-1-(3,4,5-trimethyl-1H-pyrrol-2-yl)buta-1,3-dien-2-yl]aniline |
|---|---|
| PubChem CID | 142164142 |
| Molecular Formula | C18H21ClN2 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 4-chloro-N-methyl-2-[(1E)-1-(3,4,5-trimethyl-1H-pyrrol-2-yl)buta-1,3-dien-2-yl]aniline |
| SMILES | C=C/C(=C\c1[nH]c(C)c(C)c1C)c1cc(Cl)ccc1NC |
| InChI | InChI=1S/C18H21ClN2/c1-6-14(9-18-12(3)11(2)13(4)21-18)16-10-15(19)7-8-17(16)20-5/h6-10,20-21H,1H2,2-5H3/b14-9+ |
| InChIKey | UHYBDKBNZRYXIK-NTEUORMPSA-N |
| XLogP | 5.36 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|