C18H28N2 — CID 142165994
ethane;(3Z)-1-N-ethenyl-3-ethylidene-6-methylidene-2-N-[(Z)-prop-1-enyl]cyclohex-4-ene-1,2-diimine (PubChem CID 142165994) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is ethane;(3Z)-1-N-ethenyl-3-ethylidene-6-methylidene-2-N-[(Z)-prop-1-enyl]cyclohex-4-ene-1,2-diimine.
| Compound Name | ethane;(3Z)-1-N-ethenyl-3-ethylidene-6-methylidene-2-N-[(Z)-prop-1-enyl]cyclohex-4-ene-1,2-diimine |
|---|---|
| PubChem CID | 142165994 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | ethane;(3Z)-1-N-ethenyl-3-ethylidene-6-methylidene-2-N-[(Z)-prop-1-enyl]cyclohex-4-ene-1,2-diimine |
| SMILES | C=C/N=C1\C(=C)C=CC(=C/C)/C1=N/C=C\C.CC.CC |
| InChI | InChI=1S/C14H16N2.2C2H6/c1-5-10-16-14-12(6-2)9-8-11(4)13(14)15-7-3;2*1-2/h5-10H,3-4H2,1-2H3;2*1-2H3/b10-5-,12-6-,15-13+,16-14-;; |
| InChIKey | ZKVBKXXTNUWBCK-LSPUQHEQSA-N |
| XLogP | 5.67 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|