C24H37NO5S — CID 142167262
ethane;2-[[4-(3-ethoxy-4-methoxyphenyl)phenyl]methylsulfonyl]-N-ethylacetamide (PubChem CID 142167262) has the molecular formula C24H37NO5S and a molecular weight of 451.63 g/mol. Its IUPAC name is ethane;2-[[4-(3-ethoxy-4-methoxyphenyl)phenyl]methylsulfonyl]-N-ethylacetamide.
| Compound Name | ethane;2-[[4-(3-ethoxy-4-methoxyphenyl)phenyl]methylsulfonyl]-N-ethylacetamide |
|---|---|
| PubChem CID | 142167262 |
| Molecular Formula | C24H37NO5S |
| Molecular Weight | 451.63 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | ethane;2-[[4-(3-ethoxy-4-methoxyphenyl)phenyl]methylsulfonyl]-N-ethylacetamide |
| SMILES | CC.CC.CCNC(=O)CS(=O)(=O)Cc1ccc(-c2ccc(OC)c(OCC)c2)cc1 |
| InChI | InChI=1S/C20H25NO5S.2C2H6/c1-4-21-20(22)14-27(23,24)13-15-6-8-16(9-7-15)17-10-11-18(25-3)19(12-17)26-5-2;2*1-2/h6-12H,4-5,13-14H2,1-3H3,(H,21,22);2*1-2H3 |
| InChIKey | WKRDKRUNZUGBKH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.63 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |